cas: 1105193-70-1 — see every product listed under this CAS number, including other names
(6-oxo-4-phenylpyrimidin-1(6{H})-yl)acetic acid, 95% (CAS 1105193-70-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A711861-5g |
| cas | 1105193-70-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13610.80 Pln | |
| AmBeed | 10g | 19027.12 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(6-oxo-4-phenylpyrimidin-1-yl)acetic acid (CAS 1105193-70-1) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-(6-oxo-4-phenylpyrimidin-1-yl)acetic acid. InChIKey: QRPMZNROSUZRLG-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-(6-oxo-4-phenylpyrimidin-1-yl)acetic acid |
| InChIKey | QRPMZNROSUZRLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)N(C=N2)CC(=O)O |
Computed by PubChem (NCBI)