CAS 15596-57-3 appears in our catalog under these names: 4,4'-Dihydroxyazoxybenzene, 95%, Phenacetin Impurity 1 (4,4'-Azoxydiphenol), 4,4'–Dihydroxyazoxybenzene. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 100mg, 250mg, on request, 25mg, 5mg.
(4-hydroxyphenyl)-(4-hydroxyphenyl)imino-oxidoazanium (CAS 15596-57-3) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: (4-hydroxyphenyl)-(4-hydroxyphenyl)imino-oxidoazanium. InChIKey: VCVDNSCCCADAHZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (4-hydroxyphenyl)-(4-hydroxyphenyl)imino-oxidoazanium |
| InChIKey | VCVDNSCCCADAHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+](C2=CC=C(C=C2)O)[O-])O |
Computed by PubChem (NCBI)