CAS 54558-06-4 is the registry number for 6-(2,3-Dihydro-1,4-benzodioxin-6-yl)pyridazin-3-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyridazin-6-one (CAS 54558-06-4) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyridazin-6-one. InChIKey: AFBVWGIDZFYWLV-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyridazin-6-one |
| InChIKey | AFBVWGIDZFYWLV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=NNC(=O)C=C3 |
Computed by PubChem (NCBI)