CAS 61862-29-1 appears in our catalog under these names: N-[3-(2,5-Dioxo-2,5-dihydro-1h-pyrrol-1-yl)phenyl]acetamide, 95%, N-(3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)phenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g.
N-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetamide (CAS 61862-29-1) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: N-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetamide. InChIKey: UYCLQMPQVKMMJO-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | N-[3-(2,5-dioxopyrrol-1-yl)phenyl]acetamide |
| InChIKey | UYCLQMPQVKMMJO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)