cas: 24701-69-7 — see every product listed under this CAS number, including other names
(6R,7R)-7-AMINO-3-(METHOXYMETHYL)-8-OXO-5-THIA-1-AZABICYCLO[4.2.0]OCT-2-ENE-2-CARBOXYLIC ACID, 95% (CAS 24701-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F796809-1G |
| cas | 24701-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 25g | 1013.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 24701-69-7) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: (6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: BDSDFCVDQUGOFB-SVGQVSJJSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | BDSDFCVDQUGOFB-SVGQVSJJSA-N |
| SMILES | COCC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)