CAS 5580-20-1 appears in our catalog under these names: 4-Thio-2'-deoxyuridine, 95%, 2’-Deoxy-4-thiouridine, 4–Thio–2'–deoxyuridine, 2'-Deoxy-4-thiouridine, 2'-Deoxy-4-thiouridine, >95.0%(HPLC)(qNMR). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 100mg, 2mg, 50mg, 1g, 10mM/1mL, 5 mg, 50 mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (CAS 5580-20-1) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one. InChIKey: PHNDUXLWAVSUAL-SHYZEUOFSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| InChIKey | PHNDUXLWAVSUAL-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=S)NC2=O)CO)O |
Computed by PubChem (NCBI)