CAS 24954-60-7 is the registry number for N-[2-(4-Nitrophenyl)ethyl]methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[2-(4-nitrophenyl)ethyl]methanesulfonamide (CAS 24954-60-7) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: N-[2-(4-nitrophenyl)ethyl]methanesulfonamide. InChIKey: NJCUPWWIUJMALZ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | N-[2-(4-nitrophenyl)ethyl]methanesulfonamide |
| InChIKey | NJCUPWWIUJMALZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)