CAS 28860-10-8 appears in our catalog under these names: N-Isopropyl 3-nitrobenzenesulfonamide, 98%, N-Isopropyl-3-nitrobenzenesulfonamide, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 100g, 1g.
3-nitro-N-propan-2-ylbenzenesulfonamide (CAS 28860-10-8) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 3-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: YMQDOINNAIAMAP-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 3-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | YMQDOINNAIAMAP-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)