Products 99362-95-5
CAS 99362-95-5 appears in our catalog under these names: Methyl ([(4-aminophenyl)sulfonyl]amino)acetate, 95%, METHYL{((4-AMINOPHENYL)SULFONYL)AMINO}ACETATE, 95%, Methyl 2-(4-aminobenzenesulfonamido)acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
Methyl 2-[(4-aminophenyl)sulfonylamino]acetate (CAS 99362-95-5) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: methyl 2-[(4-aminophenyl)sulfonylamino]acetate. InChIKey: ZOWMDAHNZAIHGK-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | methyl 2-[(4-aminophenyl)sulfonylamino]acetate |
| InChIKey | ZOWMDAHNZAIHGK-UHFFFAOYSA-N |
| SMILES | COC(=O)CNS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)