CAS 90250-68-3 appears in our catalog under these names: 4-([(Dimethylamino)sulfonyl]amino)benzoic acid, 95%, 4-((N,N-Dimethylsulfamoyl)amino)benzoic acid, 97%, 4-{((Dimethylamino)sulfonyl)amino}benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg.
4-(dimethylsulfamoylamino)benzoic acid (CAS 90250-68-3) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 4-(dimethylsulfamoylamino)benzoic acid. InChIKey: GIHVRYUPCABTQW-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 4-(dimethylsulfamoylamino)benzoic acid |
| InChIKey | GIHVRYUPCABTQW-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)