(6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 95%
cas: 24701-69-7 — see every product listed under this CAS number, including other names
(6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 95% (CAS 24701-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A446079-1g |
| cas | 24701-69-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1182.50 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 746.00 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 25g | 1382.86 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 25g | 1269.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 24701-69-7) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: (6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: BDSDFCVDQUGOFB-SVGQVSJJSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | BDSDFCVDQUGOFB-SVGQVSJJSA-N |
| SMILES | COCC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)