cas: 50402-83-0 — see every product listed under this CAS number, including other names
(7-methyl-2-oxo-2H-chromen-4-yl)acetic acid, ≥95%, ≥95% (CAS 50402-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD2F-250mg |
| cas | 50402-83-0 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 2642.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(7-methyl-2-oxochromen-4-yl)acetic acid (CAS 50402-83-0) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 2-(7-methyl-2-oxochromen-4-yl)acetic acid. InChIKey: VDQLZKYCWITDPF-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-(7-methyl-2-oxochromen-4-yl)acetic acid |
| InChIKey | VDQLZKYCWITDPF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)O |
Computed by PubChem (NCBI)