CAS 36914-75-7 is the registry number for 7-(2-Oxopropoxy)-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
7-(2-oxopropoxy)chromen-2-one (CAS 36914-75-7) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 7-(2-oxopropoxy)chromen-2-one. InChIKey: STOJMJQGRRERKR-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 7-(2-oxopropoxy)chromen-2-one |
| InChIKey | STOJMJQGRRERKR-UHFFFAOYSA-N |
| SMILES | CC(=O)COC1=CC2=C(C=C1)C=CC(=O)O2 |
Computed by PubChem (NCBI)