cas: 351184-42-4 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 4-hydroxypiperidine-1-carboxylate, 97%,RG, 97%,RG (CAS 351184-42-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYYF-5g |
| cas | 351184-42-4 |
| size | 5g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2790.80 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 698.00 Pln |
| purity | 97%,RG |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate (CAS 351184-42-4) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate. InChIKey: DANUFRHHXWZNIK-UHFFFAOYSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate |
| InChIKey | DANUFRHHXWZNIK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)