Products 1375069-29-6

CAS 1375069-29-6 is the registry number for {4-[4-(Piperidinocarbonyl)phenyl]phenyl}acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid (CAS 1375069-29-6) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 2-[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid. InChIKey: JVGUJFHLJQWVBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO3
Molecular weight323.4 g/mol
IUPAC name2-[4-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid
InChIKeyJVGUJFHLJQWVBQ-UHFFFAOYSA-N
SMILESC1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)CC(=O)O

Computed by PubChem (NCBI)