Products 147959-03-3

CAS 147959-03-3 is the registry number for 1-(Diphenylacetyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2,2-diphenylacetyl)piperidine-4-carboxylic acid (CAS 147959-03-3) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 1-(2,2-diphenylacetyl)piperidine-4-carboxylic acid. InChIKey: PBINQPNNMCKXLT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO3
Molecular weight323.4 g/mol
IUPAC name1-(2,2-diphenylacetyl)piperidine-4-carboxylic acid
InChIKeyPBINQPNNMCKXLT-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C(=O)C(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)