Products 1820704-95-7

CAS 1820704-95-7 is the registry number for methyl 2-(4-{3-[(pyrrolidin-1-yl)carbonyl]phenyl}phenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetate (CAS 1820704-95-7) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: methyl 2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetate. InChIKey: OPKHQSQMODLGJW-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO3
Molecular weight323.4 g/mol
IUPAC namemethyl 2-[4-[3-(pyrrolidine-1-carbonyl)phenyl]phenyl]acetate
InChIKeyOPKHQSQMODLGJW-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)N3CCCC3

Computed by PubChem (NCBI)