CAS 1381944-32-6 is the registry number for (3-{4-[(piperidin-1-yl)carbonyl]phenyl}phenyl)acetic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid (CAS 1381944-32-6) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid. InChIKey: KMYKGIFEUAGYQU-UHFFFAOYSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetic acid |
| InChIKey | KMYKGIFEUAGYQU-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=CC=CC(=C3)CC(=O)O |
Computed by PubChem (NCBI)