Products 933474-39-6

CAS 933474-39-6 is the registry number for 1-BOC-6-benzyloxyindole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-phenylmethoxyindole-1-carboxylate (CAS 933474-39-6) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: tert-butyl 6-phenylmethoxyindole-1-carboxylate. InChIKey: SRPBCFXYURDQFS-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO3
Molecular weight323.4 g/mol
IUPAC nametert-butyl 6-phenylmethoxyindole-1-carboxylate
InChIKeySRPBCFXYURDQFS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)