cas: 123367-27-1 — see every product listed under this CAS number, including other names
(E)–3–(Dimethylamino)–1–(pyridin–4–yl)prop–2–en–1–one (CAS 123367-27-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD12315-1g |
| cas | 123367-27-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 657.89 Pln | |
| GLPBio | 250mg | 615.76 Pln | |
| GLPBio | 25g | 2478.60 Pln | |
| GLPBio | 5g | 1093.17 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one (CAS 123367-27-1) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one. InChIKey: JZGHSXBVKSMAKH-VMPITWQZSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one |
| InChIKey | JZGHSXBVKSMAKH-VMPITWQZSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)