CAS 66521-53-7 appears in our catalog under these names: Imatinib Impurity 39, (2E)-N,N-Dimethyl-3-(pyridin-4-yl)prop-2-enamide, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g, 5g, 25g, 100g.
(E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one (CAS 66521-53-7) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one. InChIKey: JZGHSXBVKSMAKH-VMPITWQZSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one |
| InChIKey | JZGHSXBVKSMAKH-VMPITWQZSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)