(E)-(4-Methoxystyryl)boronic acid, 98%, 98%
cas: 72316-18-8 — see every product listed under this CAS number, including other names
(E)-(4-Methoxystyryl)boronic acid, 98%, 98% (CAS 72316-18-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178OI-100mg |
| cas | 72316-18-8 |
| size | 100mg |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2416.40 Pln | |
| Chemat | 25g | 5315.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(E)-2-(4-methoxyphenyl)ethenyl]boronic acid (CAS 72316-18-8) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: [(E)-2-(4-methoxyphenyl)ethenyl]boronic acid. InChIKey: LGSBCAPDUJYMOQ-VOTSOKGWSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | [(E)-2-(4-methoxyphenyl)ethenyl]boronic acid |
| InChIKey | LGSBCAPDUJYMOQ-VOTSOKGWSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
trans-2-(4-Methoxyphenyl)vinylboronic acid, (E)-(4-Methoxystyryl)boronic acid, [(E)-2-(4-methoxyphenyl)ethenyl]boronic acid, (E)-4-Methoxystyrylboronic acid, [(E)-2-(4-methoxyphenyl)vinyl]boronic acid, (4-Methoxystyryl)boronic acid, (E)-(4-Methoxystyryl)boronicacid, [(1E)-2-(4-methoxyphenyl)ethenyl]boronic acid, LGSBCAPDUJYMOQ-VOTSOKGWSA-N, 2-(4-methoxyphenyl)ethenylboronic acid