(E)-2-Phenylethene-1-sulfonyl chloride, 97%
cas: 52147-97-4 — see every product listed under this CAS number, including other names
(E)-2-Phenylethene-1-sulfonyl chloride, 97% (CAS 52147-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A491072-250mg |
| cas | 52147-97-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 10g | 715.25 Pln | |
| Ambeed | 25g | 1104.63 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 425.43 Pln | |
| BLDpharm | 10g | 764.20 Pln | |
| BLDpharm | 25g | 1180.72 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(E)-2-phenylethenesulfonyl chloride (CAS 52147-97-4) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: (E)-2-phenylethenesulfonyl chloride. InChIKey: ONWRSBMOCIQLRK-VOTSOKGWSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | (E)-2-phenylethenesulfonyl chloride |
| InChIKey | ONWRSBMOCIQLRK-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
(E)-2-phenylethene-1-sulfonyl chloride, (E)-2-Phenylethenesulfonyl chloride, 2-Phenylethenesulfonyl chloride, beta-styrene sulfonyl chloride, trans-beta-Styrenesulfonyl chloride, (E)-2-phenyl-ethenesulfonyl chloride, 2-phenylethene-1-sulfonyl chloride, Ethenesulfonyl chloride, 2-phenyl-, Styrylsulfonyl chloride, Styrene-beta-sulphonyl chloride