CAS 4091-26-3 appears in our catalog under these names: 2-Phenylethenesulfonyl chloride, 98%, (E)-2-Phenylethenesulfonyl chloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 2.5g.
(E)-2-phenylethenesulfonyl chloride (CAS 4091-26-3) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: (E)-2-phenylethenesulfonyl chloride. InChIKey: ONWRSBMOCIQLRK-VOTSOKGWSA-N.
| Molecular formula | C8H7ClO2S |
|---|---|
| Molecular weight | 202.66 g/mol |
| IUPAC name | (E)-2-phenylethenesulfonyl chloride |
| InChIKey | ONWRSBMOCIQLRK-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)Cl |
Computed by PubChem (NCBI)