(E)-3-(4-Ethylphenyl)acrylic acid, 98%
cas: 120680-98-0 — see every product listed under this CAS number, including other names
(E)-3-(4-Ethylphenyl)acrylic acid, 98% (CAS 120680-98-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1219516-250mg |
| cas | 120680-98-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 815.38 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 803.08 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 822.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(4-ethylphenyl)prop-2-enoic acid (CAS 120680-98-0) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(4-ethylphenyl)prop-2-enoic acid. InChIKey: GOIIVCHICYNWSG-BQYQJAHWSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(4-ethylphenyl)prop-2-enoic acid |
| InChIKey | GOIIVCHICYNWSG-BQYQJAHWSA-N |
| SMILES | CCC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)