CAS 19936-19-7 appears in our catalog under these names: 3-Cyclobutylbenzoic acid, 95%, 3-Cyclobutylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.
3-cyclobutylbenzoic acid (CAS 19936-19-7) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-cyclobutylbenzoic acid. InChIKey: UJQRIEBZAHFCEV-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-cyclobutylbenzoic acid |
| InChIKey | UJQRIEBZAHFCEV-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)