CAS 67688-87-3 appears in our catalog under these names: (2E)-3-(3,5-Dimethylphenyl)prop-2-enoic acid, (2E)-3-(3,5-dimethylphenyl)prop-2-enoic acid, 96%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 1g, 10g, 25g, 5g.
(E)-3-(3,5-dimethylphenyl)prop-2-enoic acid (CAS 67688-87-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(3,5-dimethylphenyl)prop-2-enoic acid. InChIKey: KNCJKIAOBVEDSY-ONEGZZNKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(3,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | KNCJKIAOBVEDSY-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)