CAS 28784-98-7 appears in our catalog under these names: 4-Ethylcinnamic acid, 95%, 3–(4–Ethylphenyl)acrylic acid, 4-Ethylcinnamic acid, 97% (E), 97% (E), 3-(4-Ethylphenyl)acrylic acid, 97%, 3-(4-Ethylphenyl)acrylic acid, 97% (E). Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(E)-3-(4-ethylphenyl)prop-2-enoic acid (CAS 28784-98-7) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(4-ethylphenyl)prop-2-enoic acid. InChIKey: GOIIVCHICYNWSG-BQYQJAHWSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(4-ethylphenyl)prop-2-enoic acid |
| InChIKey | GOIIVCHICYNWSG-BQYQJAHWSA-N |
| SMILES | CCC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)