Products 40641-90-5
CAS 40641-90-5 appears in our catalog under these names: 2-(4-Cyclopropylphenyl)acetic acid, 95%, 4-Cyclopropylphenylacetic acid, 2-(4-Cyclopropylphenyl)acetic acid 98%, 2-(4-Cyclopropylphenyl)acetic Acid, 98%, 98%, 2-(4-CYCLOPROPYLPHENYL)ACETIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g.
2-(4-cyclopropylphenyl)acetic acid (CAS 40641-90-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)acetic acid. InChIKey: GPLBEAZWBXIBCQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-(4-cyclopropylphenyl)acetic acid |
| InChIKey | GPLBEAZWBXIBCQ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)