CAS 909698-10-8 appears in our catalog under these names: 4-Cyclopropyl-2-methylbenzoic acid, 98%, 4–Cyclopropyl–2–methylbenzoic acid, 4-Cyclopropyl-2-methylbenzoic acid, 4-Cyclopropyl-2-methylbenzoic acid 98%, 4-Cyclopropyl-2-methylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
4-cyclopropyl-2-methylbenzoic acid (CAS 909698-10-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 4-cyclopropyl-2-methylbenzoic acid. InChIKey: HMTLOHPHMSYDEB-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 4-cyclopropyl-2-methylbenzoic acid |
| InChIKey | HMTLOHPHMSYDEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)