cas: 113641-76-2 — see every product listed under this CAS number, including other names
(E)-3-(4-IODOPHENYL)ACRYLIC ACID, 97% (CAS 113641-76-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F836830-250MG |
| cas | 113641-76-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1278.73 Pln | |
| Fluorochem | 10g | 2424.16 Pln | |
| Fluorochem | 25g | 4793.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(4-iodophenyl)prop-2-enoic acid (CAS 113641-76-2) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: (E)-3-(4-iodophenyl)prop-2-enoic acid. InChIKey: NIDLJAPEZBFHGP-ZZXKWVIFSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | (E)-3-(4-iodophenyl)prop-2-enoic acid |
| InChIKey | NIDLJAPEZBFHGP-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)I |
Computed by PubChem (NCBI)