CAS 111873-46-2 appears in our catalog under these names: 4–Iodocubane–1–carboxylic acid, 8-Iodocubane-1-carboxylic acid, 4-Iodocubane-1-carboxylic acid 98%, 4-Iodocubane-1-carboxylic acid, 97%, 97%, 4-IODOCUBANE-1-CARBOXYLIC ACID, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
4-iodocubane-1-carboxylic acid (CAS 111873-46-2) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: 4-iodocubane-1-carboxylic acid. InChIKey: UQMHINRLKQGLQV-UHFFFAOYSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | 4-iodocubane-1-carboxylic acid |
| InChIKey | UQMHINRLKQGLQV-UHFFFAOYSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)I)C(=O)O |
Computed by PubChem (NCBI)