CAS 340682-23-7 appears in our catalog under these names: 2-Propenoic acid, 3-(3-iodophenyl)-, (2E)-, 98%, 98%, (E)-3-(3-Iodophenyl)acrylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(E)-3-(3-iodophenyl)prop-2-enoic acid (CAS 340682-23-7) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: (E)-3-(3-iodophenyl)prop-2-enoic acid. InChIKey: XQOFQTFBKOHMCW-SNAWJCMRSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | (E)-3-(3-iodophenyl)prop-2-enoic acid |
| InChIKey | XQOFQTFBKOHMCW-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)I)/C=C/C(=O)O |
Computed by PubChem (NCBI)