CAS 41070-12-6 appears in our catalog under these names: 3-(3-Iodophenyl)acrylic acid, 95%, 3–(3–Iodophenyl)acrylic acid, 3-(3-Iodophenyl)acrylic acid 95% (E), 3-(3-Iodophenyl)acrylic acid, 95% (E), 95% (E), 3-IODOCINNAMIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(E)-3-(3-iodophenyl)prop-2-enoic acid (CAS 41070-12-6) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: (E)-3-(3-iodophenyl)prop-2-enoic acid. InChIKey: XQOFQTFBKOHMCW-SNAWJCMRSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | (E)-3-(3-iodophenyl)prop-2-enoic acid |
| InChIKey | XQOFQTFBKOHMCW-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)I)/C=C/C(=O)O |
Computed by PubChem (NCBI)