CAS 896132-98-2 is the registry number for 5-Hydroxy-4-iodo-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-4-iodo-2,3-dihydroinden-1-one (CAS 896132-98-2) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: 5-hydroxy-4-iodo-2,3-dihydroinden-1-one. InChIKey: NDGFDKJAHGACHM-UHFFFAOYSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | 5-hydroxy-4-iodo-2,3-dihydroinden-1-one |
| InChIKey | NDGFDKJAHGACHM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)O)I |
Computed by PubChem (NCBI)