CAS 113641-76-2 appears in our catalog under these names: 4-Iodocinnamic acid, 98%, (E)-3-(4-Iodophenyl)Acrylic Acid, 97%, 97%, (E)-3-(4-IODOPHENYL)ACRYLIC ACID, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
(E)-3-(4-iodophenyl)prop-2-enoic acid (CAS 113641-76-2) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: (E)-3-(4-iodophenyl)prop-2-enoic acid. InChIKey: NIDLJAPEZBFHGP-ZZXKWVIFSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | (E)-3-(4-iodophenyl)prop-2-enoic acid |
| InChIKey | NIDLJAPEZBFHGP-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)I |
Computed by PubChem (NCBI)