cas: 123367-27-1 — see every product listed under this CAS number, including other names
(E)-3-(Dimethylamino)-1-(pyridin-4-yl)prop-2-en-1-one 98% (CAS 123367-27-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1599366-250mg |
| cas | 123367-27-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 1694.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1599366 |
(E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one (CAS 123367-27-1) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one. InChIKey: JZGHSXBVKSMAKH-VMPITWQZSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-pyridin-4-ylprop-2-en-1-one |
| InChIKey | JZGHSXBVKSMAKH-VMPITWQZSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)