(E)-4-Oxo-4-phenylbut-2-enoic acid, 95%
cas: 17812-07-6 — see every product listed under this CAS number, including other names
(E)-4-Oxo-4-phenylbut-2-enoic acid, 95% (CAS 17812-07-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A207759-5g |
| cas | 17812-07-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 370.38 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2984.75 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 341.56 Pln | |
| Fluorochem | 25g | 622.72 Pln | |
| Fluorochem | 100g | 2294.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 264.38 Pln | |
| BLDpharm | 10g | 397.66 Pln | |
| BLDpharm | 25g | 864.16 Pln | |
| BLDpharm | 100g | 2930.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(E)-4-oxo-4-phenylbut-2-enoic acid (CAS 17812-07-6) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-4-oxo-4-phenylbut-2-enoic acid. InChIKey: PLPDHGOODMBBGN-VOTSOKGWSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-4-oxo-4-phenylbut-2-enoic acid |
| InChIKey | PLPDHGOODMBBGN-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoylacrylic acid, 3-Benzoylacrylic acid, (E)-4-oxo-4-phenylbut-2-enoic acid, 4-Oxo-4-phenyl-2-butenoic acid, 4-oxo-4-phenylbut-2-enoic acid, (2E)-4-oxo-4-phenylbut-2-enoic acid, Acrylic acid, 3-benzoyl-, 2-Butenoic acid, 4-oxo-4-phenyl-, Crotonic acid, 4-oxo-4-phenyl-, trans-3-Benzoylacrylic acid