CAS 23359-08-2 appears in our catalog under these names: 4-Formylcinnamic acid, 95%, Ozagrel Impurity 16 (4-Formylcinnamic Acid), 4-Formylcinnamic acid, 98%, predominantly trans, 4-Formylcinnamic acid, predominantly trans 98% (E), 4-FORMYLCINNAMIC ACID, PREDOMINANTLY TR&. Offered by: Combi-blocks, Chemat Brand, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 5g, 1g, on request, 25g, 100mg, 250mg.
(E)-3-(4-formylphenyl)prop-2-enoic acid (CAS 23359-08-2) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-3-(4-formylphenyl)prop-2-enoic acid. InChIKey: LBOUHDMYVURTMA-AATRIKPKSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-3-(4-formylphenyl)prop-2-enoic acid |
| InChIKey | LBOUHDMYVURTMA-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)C=O |
Computed by PubChem (NCBI)