Products 1914-59-6
CAS 1914-59-6 appears in our catalog under these names: (3E)-2-Oxo-4-phenylbut-3-enoic acid, 97%, (3E)-2-Oxo-4-phenyl-3-butenoic acid, 98%, 98%, (3e)-2-Oxo-4-phenylbut-3-enoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
(E)-2-oxo-4-phenylbut-3-enoic acid (CAS 1914-59-6) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-2-oxo-4-phenylbut-3-enoic acid. InChIKey: YQOUMBVFEWZLME-VOTSOKGWSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-2-oxo-4-phenylbut-3-enoic acid |
| InChIKey | YQOUMBVFEWZLME-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3E)-2-Oxo-4-phenyl-3-butenoic acid, (E)-2-oxo-4-phenylbut-3-enoic acid, 2-oxo-4-phenylbut-3-enoic acid, (E)-2-oxo-4-phenyl-but-3-enoic acid, 3-Butenoic acid, 2-oxo-4-phenyl-, (3E)-, 2-Oxo-4-phenyl-but-3-enoic acid, 3-Butenoic acid, 2-oxo-4-phenyl-, 3-Butenoic acid, 2-oxo-4-phenyl-, (E)-, (E)-2-Oxo-4-phenyl-3-butenoic acid, 2-oxo-4-phenylbut-3-enoicacid