Products 62119-70-4
CAS 62119-70-4 appears in our catalog under these names: 2-Benzofuranacetic acid, 96%, 2-Benzofuranacetic acid, 2–Benzofuranacetic acid, 2-(Benzofuran-2-yl)acetic acid, 2-Benzofuranacetic acid 96%. Offered by: Combi-blocks, Chemat, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 2g, 50mg, 10g, 25g.
2-(1-benzofuran-2-yl)acetic acid (CAS 62119-70-4) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)acetic acid. InChIKey: ZYIXXVCNAOYWQA-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)acetic acid |
| InChIKey | ZYIXXVCNAOYWQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)CC(=O)O |
Computed by PubChem (NCBI)