CAS 583-06-2 appears in our catalog under these names: 4-Oxo-4-phenylbut-2-enoic acid, 96%, 3-Benzoylacrylic acid, 95%, 3-Benzoylacrylic acid/ 97+%, 3-Benzoylacrylic acid, predominantly trans, 97% . Offered by: Fluorochem, Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 10g, 25g, 100g, 1g.
(E)-4-oxo-4-phenylbut-2-enoic acid (CAS 583-06-2) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-4-oxo-4-phenylbut-2-enoic acid. InChIKey: PLPDHGOODMBBGN-VOTSOKGWSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-4-oxo-4-phenylbut-2-enoic acid |
| InChIKey | PLPDHGOODMBBGN-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)