CAS 1131-15-3 appears in our catalog under these names: 3-phenyloxolane-2,5-dione, 98%, 3-Phenyldihydrofuran-2,5-dione, 99%, 3-Phenyldihydrofuran-2,5-dione, 99%, 99%, Phenylsuccinic anhydride, 97%, Phenylsuccinic anhydride. Offered by: Fluorochem, Ambeed, Chemat, Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 50g.
3-phenyloxolane-2,5-dione (CAS 1131-15-3) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 3-phenyloxolane-2,5-dione. InChIKey: HDFKMLFDDYWABF-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-phenyloxolane-2,5-dione |
| InChIKey | HDFKMLFDDYWABF-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)