cas: 1191901-33-3 — see every product listed under this CAS number, including other names
(E)-Cyclooct-4-en-1-yl (2,5-dioxopyrrolidin-1-yl) carbonate, 95% rel-(1R-4E-pR)-equatorial, 95% rel-(1R-4E-pR)-equatorial (CAS 1191901-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107E0-10mg |
| cas | 1191901-33-3 |
| size | 10mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 390.80 Pln | |
| Chemat | 25mg | 650.00 Pln | |
| Chemat | 50mg | 1058.00 Pln | |
| Chemat | 100mg | 1763.60 Pln | |
| Chemat | 250mg | 2949.20 Pln | |
| Chemat | 1g | 7125.20 Pln | |
| Chemat | 5g | 17310.80 Pln |
| purity | 95% rel-(1R-4E-pR)-equatorial |
|---|---|
| delivery time | 3 weeks |
[(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1191901-33-3) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: [(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: OUGQJOKGFAIFAQ-OWOJBTEDSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | [(4E)-cyclooct-4-en-1-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | OUGQJOKGFAIFAQ-OWOJBTEDSA-N |
| SMILES | C1C/C=C/CCC(C1)OC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)