CAS 942404-97-9 appears in our catalog under these names: Methyl 5-(tert-butoxycarbonylamino)-2-hydroxybenzoate, 95%, 5-(((1,1-Dimethylethoxy)carbonyl)amino)-2-hydroxybenzoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 25g, 5g.
Methyl 2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 942404-97-9) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl 2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: KBOFORFWNCUDDX-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl 2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| InChIKey | KBOFORFWNCUDDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)O)C(=O)OC |
Computed by PubChem (NCBI)