CAS 290366-76-6 is the registry number for Ethyl 3-(2-methoxyphenyl)-4-nitrobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl 3-(2-methoxyphenyl)-4-nitrobutanoate (CAS 290366-76-6) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: ethyl 3-(2-methoxyphenyl)-4-nitrobutanoate. InChIKey: XWJLFKQKXXOWHQ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | ethyl 3-(2-methoxyphenyl)-4-nitrobutanoate |
| InChIKey | XWJLFKQKXXOWHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C[N+](=O)[O-])C1=CC=CC=C1OC |
Computed by PubChem (NCBI)