cas: 24393-50-8 — see every product listed under this CAS number, including other names
(E)-Ethyl 3-(4-fluorophenyl)acrylate 97% (CAS 24393-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755240-250mg |
| cas | 24393-50-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1071.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755240 |
Ethyl (E)-3-(4-fluorophenyl)prop-2-enoate (CAS 24393-50-8) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: ethyl (E)-3-(4-fluorophenyl)prop-2-enoate. InChIKey: UNAXNPTZJKKUGO-VMPITWQZSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | ethyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| InChIKey | UNAXNPTZJKKUGO-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)