CAS 1429551-15-4 is the registry number for 4-Fluoro-3,5-dimethylcinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(4-fluoro-3,5-dimethylphenyl)prop-2-enoic acid (CAS 1429551-15-4) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: (E)-3-(4-fluoro-3,5-dimethylphenyl)prop-2-enoic acid. InChIKey: ZZSIWROWICLMIQ-ONEGZZNKSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | (E)-3-(4-fluoro-3,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | ZZSIWROWICLMIQ-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)