CAS 179411-84-8 appears in our catalog under these names: 1-(3-Fluorophenyl)cyclobutane-1-carboxylic acid, 97%, 1–(3–fluorophenyl)cyclobutane–1–carboxylic acid, 1-(3-Fluorophenyl)cyclobutane-1-carboxylic acid, 1-(3-Fluorophenyl)cyclobutanecarboxylic acid, 95%, 95%, 1-(3-Fluorophenyl)cyclobutane-1-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
1-(3-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 179411-84-8) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 1-(3-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: AHZJCDUFTPVPFM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 1-(3-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | AHZJCDUFTPVPFM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)