CAS 151157-48-1 appears in our catalog under these names: 1–(2–fluorophenyl)cyclobutane–1–carboxylic acid, 1-(2-Fluorophenyl)cyclobutane-1-carboxylic acid, 1-(2-Fluorophenyl)cyclobutane-1-carboxylic acid, 97%, 1-(2-Fluorophenyl)cyclobutane-1-carboxylic acid, 98%, 1-(2-Fluorophenyl)cyclobutanecarboxylic acid, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 1g, 2,5g, 25g, 10g, 5g, 100mg, 250mg.
1-(2-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 151157-48-1) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: SUVDKDZUAMNVGY-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | SUVDKDZUAMNVGY-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)